About 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol
5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol (PubChem CID 107707064) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol |
| PubChem CID | 107707064 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol |
| SMILES | CC(NN(C)C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H16N2O2/c1-7(11-12(2)3)8-4-9(13)6-10(14)5-8/h4-7,11,13-14H,1-3H3 |
| InChIKey | FUUPCRBHXSBMFW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol?
The IUPAC name of 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol (CID 107707064) is 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol.
What is the SMILES notation for 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol?
The canonical SMILES for 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol is CC(NN(C)C)c1cc(O)cc(O)c1.
What is the InChIKey of 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol?
The InChIKey is FUUPCRBHXSBMFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-7(11-12(2)3)8-4-9(13)6-10(14)5-8/h4-7,11,13-14H,1-3H3.
What are the key properties of 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol?
5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol has a molecular weight of 196.25 g/mol, XLogP of 1.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol is sourced from PubChem (CID 107707064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).