C10H16N2O2 — CID 107707064
5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol (PubChem CID 107707064) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707064 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 5-[1-(2,2-dimethylhydrazinyl)ethyl]benzene-1,3-diol |
| SMILES | CC(NN(C)C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H16N2O2/c1-7(11-12(2)3)8-4-9(13)6-10(14)5-8/h4-7,11,13-14H,1-3H3 |
| InChIKey | FUUPCRBHXSBMFW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|