C13H18F3NO2S — CID 107707391
6-[2-amino-4-(trifluoromethyl)phenyl]sulfinylhexan-1-ol (PubChem CID 107707391) has the molecular formula C13H18F3NO2S and a molecular weight of 309.35 g/mol. Its IUPAC name is 6-[2-amino-4-(trifluoromethyl)phenyl]sulfinylhexan-1-ol.
| Compound Name | 6-[2-amino-4-(trifluoromethyl)phenyl]sulfinylhexan-1-ol |
|---|---|
| PubChem CID | 107707391 |
| Molecular Formula | C13H18F3NO2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-[2-amino-4-(trifluoromethyl)phenyl]sulfinylhexan-1-ol |
| SMILES | Nc1cc(C(F)(F)F)ccc1S(=O)CCCCCCO |
| InChI | InChI=1S/C13H18F3NO2S/c14-13(15,16)10-5-6-12(11(17)9-10)20(19)8-4-2-1-3-7-18/h5-6,9,18H,1-4,7-8,17H2 |
| InChIKey | YZZKAPBACZFMFS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|