C16H19NO4 — CID 107707749
5-[1-hydroxy-2-(2-methoxyanilino)propan-2-yl]benzene-1,3-diol (PubChem CID 107707749) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 5-[1-hydroxy-2-(2-methoxyanilino)propan-2-yl]benzene-1,3-diol.
| Compound Name | 5-[1-hydroxy-2-(2-methoxyanilino)propan-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707749 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 5-[1-hydroxy-2-(2-methoxyanilino)propan-2-yl]benzene-1,3-diol |
| SMILES | COc1ccccc1NC(C)(CO)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H19NO4/c1-16(10-18,11-7-12(19)9-13(20)8-11)17-14-5-3-4-6-15(14)21-2/h3-9,17-20H,10H2,1-2H3 |
| InChIKey | NFLGCZRKVOHKEW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |