C14H19NO4 — CID 107707800
1-[1-(3,5-dihydroxyphenyl)ethyl]piperidine-2-carboxylic acid (PubChem CID 107707800) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-[1-(3,5-dihydroxyphenyl)ethyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[1-(3,5-dihydroxyphenyl)ethyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107707800 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[1-(3,5-dihydroxyphenyl)ethyl]piperidine-2-carboxylic acid |
| SMILES | CC(c1cc(O)cc(O)c1)N1CCCCC1C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-9(10-6-11(16)8-12(17)7-10)15-5-3-2-4-13(15)14(18)19/h6-9,13,16-17H,2-5H2,1H3,(H,18,19) |
| InChIKey | KTTIXCDMANMUPY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |