C14H19F3N2O2 — CID 107708092
5-[1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]benzene-1,3-diol (PubChem CID 107708092) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 5-[1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107708092 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 5-[1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethyl]benzene-1,3-diol |
| SMILES | CC(c1cc(O)cc(O)c1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F3N2O2/c1-10(11-6-12(20)8-13(21)7-11)19-4-2-18(3-5-19)9-14(15,16)17/h6-8,10,20-21H,2-5,9H2,1H3 |
| InChIKey | HCSLAZMHOCUXIT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |