About 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol
5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol (PubChem CID 107708163) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol |
| PubChem CID | 107708163 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol |
| SMILES | CCC(C)CN(CC)C(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H25NO2/c1-5-11(3)10-16(6-2)12(4)13-7-14(17)9-15(18)8-13/h7-9,11-12,17-18H,5-6,10H2,1-4H3 |
| InChIKey | VAQZSYGGINNLLC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol?
The IUPAC name of 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol (CID 107708163) is 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol.
What is the SMILES notation for 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol?
The canonical SMILES for 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol is CCC(C)CN(CC)C(C)c1cc(O)cc(O)c1.
What is the InChIKey of 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol?
The InChIKey is VAQZSYGGINNLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO2/c1-5-11(3)10-16(6-2)12(4)13-7-14(17)9-15(18)8-13/h7-9,11-12,17-18H,5-6,10H2,1-4H3.
What are the key properties of 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol?
5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol has a molecular weight of 251.37 g/mol, XLogP of 3.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[ethyl(2-methylbutyl)amino]ethyl]benzene-1,3-diol is sourced from PubChem (CID 107708163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).