About 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol
5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol (PubChem CID 107708200) has the molecular formula C11H15F2NO2
and a molecular weight of 231.24 g/mol. Its IUPAC name is 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol |
| PubChem CID | 107708200 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(c1cc(O)cc(O)c1)N(C)CC(F)F |
| InChI | InChI=1S/C11H15F2NO2/c1-7(14(2)6-11(12)13)8-3-9(15)5-10(16)4-8/h3-5,7,11,15-16H,6H2,1-2H3 |
| InChIKey | NMRUHNAILWLTDP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol?
The IUPAC name of 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol (CID 107708200) is 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol.
What is the SMILES notation for 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol?
The canonical SMILES for 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol is CC(c1cc(O)cc(O)c1)N(C)CC(F)F.
What is the InChIKey of 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol?
The InChIKey is NMRUHNAILWLTDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO2/c1-7(14(2)6-11(12)13)8-3-9(15)5-10(16)4-8/h3-5,7,11,15-16H,6H2,1-2H3.
What are the key properties of 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol?
5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol has a molecular weight of 231.24 g/mol, XLogP of 2.36, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[2,2-difluoroethyl(methyl)amino]ethyl]benzene-1,3-diol is sourced from PubChem (CID 107708200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).