C35H35N5O10 — CID 10770856
[(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate (PubChem CID 10770856) has the molecular formula C35H35N5O10 and a molecular weight of 685.69 g/mol. Its IUPAC name is [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate.
| Compound Name | [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate |
|---|---|
| PubChem CID | 10770856 |
| Molecular Formula | C35H35N5O10 |
| Molecular Weight | 685.69 g/mol |
| Exact Mass | 685.24 |
| IUPAC Name | [(4S)-2-acetamido-9-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-6,8-dioxo-1H-purin-4-yl] acetate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3C(=O)N=C4C(=O)NC(NC(C)=O)=N[C@@]43OC(C)=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H35N5O10/c1-20(41)36-32-38-31(44)30-35(39-32,50-21(2)42)40(33(45)37-30)29-18-27(43)28(49-29)19-48-34(22-8-6-5-7-9-22,23-10-14-25(46-3)15-11-23)24-12-16-26(47-4)17-13-24/h5-17,27-29,43H,18-19H2,1-4H3,(H2,36,38,39,41,44)/t27-,28+,29+,35-/m0/s1 |
| InChIKey | QKNLZLDSQRBROL-XXMCNVCZSA-N |
| XLogP | 2.20 |
| TPSA | 186.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|