C15H17NO2S — CID 107710302
2-[1-(3-methylsulfanylanilino)ethyl]benzene-1,3-diol (PubChem CID 107710302) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-[1-(3-methylsulfanylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(3-methylsulfanylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107710302 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-[1-(3-methylsulfanylanilino)ethyl]benzene-1,3-diol |
| SMILES | CSc1cccc(NC(C)c2c(O)cccc2O)c1 |
| InChI | InChI=1S/C15H17NO2S/c1-10(15-13(17)7-4-8-14(15)18)16-11-5-3-6-12(9-11)19-2/h3-10,16-18H,1-2H3 |
| InChIKey | VCNMXZKLRVCFID-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|