C13H13Cl2N3O2 — CID 107710331
2-[4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]phenyl]ethanol (PubChem CID 107710331) has the molecular formula C13H13Cl2N3O2 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-[4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]phenyl]ethanol.
| Compound Name | 2-[4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107710331 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-[4-[(3,5-dichloro-6-hydrazinyl-2-pyridinyl)oxy]phenyl]ethanol |
| SMILES | NNc1nc(Oc2ccc(CCO)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl2N3O2/c14-10-7-11(15)13(17-12(10)18-16)20-9-3-1-8(2-4-9)5-6-19/h1-4,7,19H,5-6,16H2,(H,17,18) |
| InChIKey | WNJGHKFIAPOFEB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|