C45H45N3O5 — CID 10771043
3-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]benzoic acid (PubChem CID 10771043) has the molecular formula C45H45N3O5 and a molecular weight of 707.87 g/mol. Its IUPAC name is 3-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]benzoic acid.
| Compound Name | 3-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10771043 |
| Molecular Formula | C45H45N3O5 |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.34 |
| IUPAC Name | 3-[[(2S)-2-[[16-(1-adamantylmethylcarbamoyl)tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl]amino]-3-phenylpropanoyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)[C@H](Cc2ccccc2)NC(=O)C2C3c4ccccc4C(c4ccccc43)C2C(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C45H45N3O5/c49-41(47-31-12-8-11-30(21-31)44(52)53)36(20-26-9-2-1-3-10-26)48-43(51)40-38-34-15-6-4-13-32(34)37(33-14-5-7-16-35(33)38)39(40)42(50)46-25-45-22-27-17-28(23-45)19-29(18-27)24-45/h1-16,21,27-29,36-40H,17-20,22-25H2,(H,46,50)(H,47,49)(H,48,51)(H,52,53)/t27?,28?,29?,36-,37?,38?,39?,40?,45?/m0/s1 |
| InChIKey | PCXMELFTIIQIIF-LJHSRLDXSA-N |
| XLogP | 6.91 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |