About 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol
2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol (PubChem CID 107710994) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol |
| PubChem CID | 107710994 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(NC1CCC(C)(C)CC1)c1c(O)cccc1O |
| InChI | InChI=1S/C16H25NO2/c1-11(15-13(18)5-4-6-14(15)19)17-12-7-9-16(2,3)10-8-12/h4-6,11-12,17-19H,7-10H2,1-3H3 |
| InChIKey | DLCLKHJDRINUHQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol?
The IUPAC name of 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol (CID 107710994) is 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol.
What is the SMILES notation for 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol?
The canonical SMILES for 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol is CC(NC1CCC(C)(C)CC1)c1c(O)cccc1O.
What is the InChIKey of 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol?
The InChIKey is DLCLKHJDRINUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO2/c1-11(15-13(18)5-4-6-14(15)19)17-12-7-9-16(2,3)10-8-12/h4-6,11-12,17-19H,7-10H2,1-3H3.
What are the key properties of 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol?
2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol has a molecular weight of 263.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(4,4-dimethylcyclohexyl)amino]ethyl]benzene-1,3-diol is sourced from PubChem (CID 107710994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).