C12H19NO3S — CID 107711277
2-[1-(1-methylsulfinylpropan-2-ylamino)ethyl]benzene-1,3-diol (PubChem CID 107711277) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-[1-(1-methylsulfinylpropan-2-ylamino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(1-methylsulfinylpropan-2-ylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711277 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-[1-(1-methylsulfinylpropan-2-ylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(CS(C)=O)NC(C)c1c(O)cccc1O |
| InChI | InChI=1S/C12H19NO3S/c1-8(7-17(3)16)13-9(2)12-10(14)5-4-6-11(12)15/h4-6,8-9,13-15H,7H2,1-3H3 |
| InChIKey | KELJMTYZTZOXDQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|