C16H28N2O2 — CID 107711458
2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol (PubChem CID 107711458) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711458 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol |
| SMILES | CCCN(CC(C)(C)CN)C(C)c1c(O)cccc1O |
| InChI | InChI=1S/C16H28N2O2/c1-5-9-18(11-16(3,4)10-17)12(2)15-13(19)7-6-8-14(15)20/h6-8,12,19-20H,5,9-11,17H2,1-4H3 |
| InChIKey | BFWQSOMDDDLRLJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|