About 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol
2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol (PubChem CID 107711458) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol |
| PubChem CID | 107711458 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol |
| SMILES | CCCN(CC(C)(C)CN)C(C)c1c(O)cccc1O |
| InChI | InChI=1S/C16H28N2O2/c1-5-9-18(11-16(3,4)10-17)12(2)15-13(19)7-6-8-14(15)20/h6-8,12,19-20H,5,9-11,17H2,1-4H3 |
| InChIKey | BFWQSOMDDDLRLJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol?
The IUPAC name of 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol (CID 107711458) is 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol.
What is the SMILES notation for 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol?
The canonical SMILES for 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol is CCCN(CC(C)(C)CN)C(C)c1c(O)cccc1O.
What is the InChIKey of 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol?
The InChIKey is BFWQSOMDDDLRLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-5-9-18(11-16(3,4)10-17)12(2)15-13(19)7-6-8-14(15)20/h6-8,12,19-20H,5,9-11,17H2,1-4H3.
What are the key properties of 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol?
2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol has a molecular weight of 280.41 g/mol, XLogP of 2.86, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(3-amino-2,2-dimethylpropyl)-propylamino]ethyl]benzene-1,3-diol is sourced from PubChem (CID 107711458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).