C14H16N2O2 — CID 107711711
2-[2-[[4-(aminomethyl)-2-pyridinyl]oxy]phenyl]ethanol (PubChem CID 107711711) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[2-[[4-(aminomethyl)-2-pyridinyl]oxy]phenyl]ethanol.
| Compound Name | 2-[2-[[4-(aminomethyl)-2-pyridinyl]oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107711711 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-[2-[[4-(aminomethyl)-2-pyridinyl]oxy]phenyl]ethanol |
| SMILES | NCc1ccnc(Oc2ccccc2CCO)c1 |
| InChI | InChI=1S/C14H16N2O2/c15-10-11-5-7-16-14(9-11)18-13-4-2-1-3-12(13)6-8-17/h1-5,7,9,17H,6,8,10,15H2 |
| InChIKey | DACDRZWIVDYSKE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |