About 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol
2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol (PubChem CID 107711739) has the molecular formula C17H20N2O2
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol.
Molecular Properties
| Compound Name | 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol |
| PubChem CID | 107711739 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol |
| SMILES | NCc1cc2c(nc1Oc1ccccc1CCO)CCC2 |
| InChI | InChI=1S/C17H20N2O2/c18-11-14-10-13-5-3-6-15(13)19-17(14)21-16-7-2-1-4-12(16)8-9-20/h1-2,4,7,10,20H,3,5-6,8-9,11,18H2 |
| InChIKey | CCXYWHCYETXSLN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol?
The IUPAC name of 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol (CID 107711739) is 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol.
What is the SMILES notation for 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol?
The canonical SMILES for 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol is NCc1cc2c(nc1Oc1ccccc1CCO)CCC2.
What is the InChIKey of 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol?
The InChIKey is CCXYWHCYETXSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2O2/c18-11-14-10-13-5-3-6-15(13)19-17(14)21-16-7-2-1-4-12(16)8-9-20/h1-2,4,7,10,20H,3,5-6,8-9,11,18H2.
What are the key properties of 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol?
2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol has a molecular weight of 284.36 g/mol, XLogP of 2.36, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[3-(aminomethyl)-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl]oxy]phenyl]ethanol is sourced from PubChem (CID 107711739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).