C14H13F2NO2 — CID 107711922
2-[2-(6-amino-2,3-difluorophenoxy)phenyl]ethanol (PubChem CID 107711922) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-[2-(6-amino-2,3-difluorophenoxy)phenyl]ethanol.
| Compound Name | 2-[2-(6-amino-2,3-difluorophenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107711922 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[2-(6-amino-2,3-difluorophenoxy)phenyl]ethanol |
| SMILES | Nc1ccc(F)c(F)c1Oc1ccccc1CCO |
| InChI | InChI=1S/C14H13F2NO2/c15-10-5-6-11(17)14(13(10)16)19-12-4-2-1-3-9(12)7-8-18/h1-6,18H,7-8,17H2 |
| InChIKey | UOJBMAHSAUDJKV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|