C13H19NO3 — CID 107712028
2-[1-[methyl(oxolan-3-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 107712028) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[1-[methyl(oxolan-3-yl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[methyl(oxolan-3-yl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107712028 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 2-[1-[methyl(oxolan-3-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(c1c(O)cccc1O)N(C)C1CCOC1 |
| InChI | InChI=1S/C13H19NO3/c1-9(14(2)10-6-7-17-8-10)13-11(15)4-3-5-12(13)16/h3-5,9-10,15-16H,6-8H2,1-2H3 |
| InChIKey | XAPDXGJPSZQZPY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|