C34H65N7O10 — CID 10771242
tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoyl]amino]butylamino]propyl]carbamate (PubChem CID 10771242) has the molecular formula C34H65N7O10 and a molecular weight of 731.93 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoyl]amino]butylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoyl]amino]butylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10771242 |
| Molecular Formula | C34H65N7O10 |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.48 |
| IUPAC Name | tert-butyl N-[3-[4-[[3-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2,2-dimethoxy-3-oxopropanoyl]amino]butylamino]propyl]carbamate |
| SMILES | COC(OC)(C(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)NCCCCNCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H65N7O10/c1-31(2,3)49-28(44)39-24-18-20-35-19-16-17-22-37-26(43)34(47-10,48-11)25(42)36-21-14-12-13-15-23-38-27(40-29(45)50-32(4,5)6)41-30(46)51-33(7,8)9/h35H,12-24H2,1-11H3,(H,36,42)(H,37,43)(H,39,44)(H2,38,40,41,45,46) |
| InChIKey | OVUFACFEIIALCN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 216.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|