C16H17NO2S — CID 107712511
3-[[2-(2-hydroxyethyl)phenoxy]methyl]benzenecarbothioamide (PubChem CID 107712511) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[[2-(2-hydroxyethyl)phenoxy]methyl]benzenecarbothioamide.
| Compound Name | 3-[[2-(2-hydroxyethyl)phenoxy]methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 107712511 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-[[2-(2-hydroxyethyl)phenoxy]methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(COc2ccccc2CCO)c1 |
| InChI | InChI=1S/C16H17NO2S/c17-16(20)14-6-3-4-12(10-14)11-19-15-7-2-1-5-13(15)8-9-18/h1-7,10,18H,8-9,11H2,(H2,17,20) |
| InChIKey | KLFAATJLQGFURT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|