C15H15BrN2O2 — CID 107712613
2-bromo-4-[2-(2-hydroxyethyl)phenoxy]benzenecarboximidamide (PubChem CID 107712613) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 2-bromo-4-[2-(2-hydroxyethyl)phenoxy]benzenecarboximidamide.
| Compound Name | 2-bromo-4-[2-(2-hydroxyethyl)phenoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 107712613 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-bromo-4-[2-(2-hydroxyethyl)phenoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2ccccc2CCO)cc1Br |
| InChI | InChI=1S/C15H15BrN2O2/c16-13-9-11(5-6-12(13)15(17)18)20-14-4-2-1-3-10(14)7-8-19/h1-6,9,19H,7-8H2,(H3,17,18) |
| InChIKey | CLLGQWCPRWCKLK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|