C43H50N2O9 — CID 10771286
3-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(3-formylphenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzaldehyde (PubChem CID 10771286) has the molecular formula C43H50N2O9 and a molecular weight of 738.88 g/mol. Its IUPAC name is 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(3-formylphenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzaldehyde.
| Compound Name | 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(3-formylphenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 10771286 |
| Molecular Formula | C43H50N2O9 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.35 |
| IUPAC Name | 3-[[(4R,5S,6S,7R)-4,7-dibenzyl-3-[(3-formylphenyl)methyl]-5,6-bis(2-methoxyethoxymethoxy)-2-oxo-1,3-diazepan-1-yl]methyl]benzaldehyde |
| SMILES | COCCOCO[C@@H]1[C@@H](OCOCCOC)[C@@H](Cc2ccccc2)N(Cc2cccc(C=O)c2)C(=O)N(Cc2cccc(C=O)c2)[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C43H50N2O9/c1-49-19-21-51-31-53-41-39(25-33-11-5-3-6-12-33)44(27-35-15-9-17-37(23-35)29-46)43(48)45(28-36-16-10-18-38(24-36)30-47)40(26-34-13-7-4-8-14-34)42(41)54-32-52-22-20-50-2/h3-18,23-24,29-30,39-42H,19-22,25-28,31-32H2,1-2H3/t39-,40-,41+,42+/m1/s1 |
| InChIKey | SPXAGSCJPSLUOM-GLGKVNTQSA-N |
| XLogP | 5.98 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|