C16H17NO3 — CID 107713704
2-[2-(2-hydroxyethyl)phenoxy]-4-methylbenzamide (PubChem CID 107713704) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethyl)phenoxy]-4-methylbenzamide.
| Compound Name | 2-[2-(2-hydroxyethyl)phenoxy]-4-methylbenzamide |
|---|---|
| PubChem CID | 107713704 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[2-(2-hydroxyethyl)phenoxy]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(Oc2ccccc2CCO)c1 |
| InChI | InChI=1S/C16H17NO3/c1-11-6-7-13(16(17)19)15(10-11)20-14-5-3-2-4-12(14)8-9-18/h2-7,10,18H,8-9H2,1H3,(H2,17,19) |
| InChIKey | LKDWYZUHYDFJAW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |