C14H17N3O2 — CID 107714111
2-[2-[(6-hydrazinyl-2-pyridinyl)methoxy]phenyl]ethanol (PubChem CID 107714111) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 2-[2-[(6-hydrazinyl-2-pyridinyl)methoxy]phenyl]ethanol.
| Compound Name | 2-[2-[(6-hydrazinyl-2-pyridinyl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107714111 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 2-[2-[(6-hydrazinyl-2-pyridinyl)methoxy]phenyl]ethanol |
| SMILES | NNc1cccc(COc2ccccc2CCO)n1 |
| InChI | InChI=1S/C14H17N3O2/c15-17-14-7-3-5-12(16-14)10-19-13-6-2-1-4-11(13)8-9-18/h1-7,18H,8-10,15H2,(H,16,17) |
| InChIKey | WDHZFMMAOMOZQC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|