C13H9Cl3N2O5 — CID 1077162
N-[(1S)-2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]furan-2-carboxamide (PubChem CID 1077162) has the molecular formula C13H9Cl3N2O5 and a molecular weight of 379.58 g/mol. Its IUPAC name is N-[(1S)-2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1077162 |
| Molecular Formula | C13H9Cl3N2O5 |
| Molecular Weight | 379.58 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | N-[(1S)-2,2,2-trichloro-1-(4-nitrophenoxy)ethyl]furan-2-carboxamide |
| SMILES | O=C(N[C@@H](Oc1ccc([N+](=O)[O-])cc1)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C13H9Cl3N2O5/c14-13(15,16)12(17-11(19)10-2-1-7-22-10)23-9-5-3-8(4-6-9)18(20)21/h1-7,12H,(H,17,19)/t12-/m0/s1 |
| InChIKey | RNUJWGCAEZHQRV-LBPRGKRZSA-N |
| XLogP | 3.69 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|