C12H12ClN3O — CID 107717861
3-chloro-2-(2,6-dimethylpyrimidin-4-yl)oxyaniline (PubChem CID 107717861) has the molecular formula C12H12ClN3O and a molecular weight of 249.70 g/mol. Its IUPAC name is 3-chloro-2-(2,6-dimethylpyrimidin-4-yl)oxyaniline.
| Compound Name | 3-chloro-2-(2,6-dimethylpyrimidin-4-yl)oxyaniline |
|---|---|
| PubChem CID | 107717861 |
| Molecular Formula | C12H12ClN3O |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 3-chloro-2-(2,6-dimethylpyrimidin-4-yl)oxyaniline |
| SMILES | Cc1cc(Oc2c(N)cccc2Cl)nc(C)n1 |
| InChI | InChI=1S/C12H12ClN3O/c1-7-6-11(16-8(2)15-7)17-12-9(13)4-3-5-10(12)14/h3-6H,14H2,1-2H3 |
| InChIKey | UKNMMQYIYBYCMA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|