C15H24FNO2 — CID 107717881
N-[1-[2-fluoro-4-(2-methoxypropoxy)phenyl]ethyl]propan-1-amine (PubChem CID 107717881) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-[1-[2-fluoro-4-(2-methoxypropoxy)phenyl]ethyl]propan-1-amine.
| Compound Name | N-[1-[2-fluoro-4-(2-methoxypropoxy)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 107717881 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[1-[2-fluoro-4-(2-methoxypropoxy)phenyl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccc(OCC(C)OC)cc1F |
| InChI | InChI=1S/C15H24FNO2/c1-5-8-17-12(3)14-7-6-13(9-15(14)16)19-10-11(2)18-4/h6-7,9,11-12,17H,5,8,10H2,1-4H3 |
| InChIKey | PUCNDXKHJFGITO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |