C15H19FN4O — CID 107718041
(1R)-1-[2-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]ethanamine (PubChem CID 107718041) has the molecular formula C15H19FN4O and a molecular weight of 290.34 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[2-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 107718041 |
| Molecular Formula | C15H19FN4O |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (1R)-1-[2-fluoro-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCc2nnc3n2CCCC3)cc1F |
| InChI | InChI=1S/C15H19FN4O/c1-10(17)12-6-5-11(8-13(12)16)21-9-15-19-18-14-4-2-3-7-20(14)15/h5-6,8,10H,2-4,7,9,17H2,1H3/t10-/m1/s1 |
| InChIKey | STQJGLJXQDBEQG-SNVBAGLBSA-N |
| XLogP | 2.35 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |