C15H23FN2O2 — CID 107718195
(1R)-1-[4-[(4-ethylmorpholin-2-yl)methoxy]-2-fluorophenyl]ethanamine (PubChem CID 107718195) has the molecular formula C15H23FN2O2 and a molecular weight of 282.36 g/mol. Its IUPAC name is (1R)-1-[4-[(4-ethylmorpholin-2-yl)methoxy]-2-fluorophenyl]ethanamine.
| Compound Name | (1R)-1-[4-[(4-ethylmorpholin-2-yl)methoxy]-2-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 107718195 |
| Molecular Formula | C15H23FN2O2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (1R)-1-[4-[(4-ethylmorpholin-2-yl)methoxy]-2-fluorophenyl]ethanamine |
| SMILES | CCN1CCOC(COc2ccc([C@@H](C)N)c(F)c2)C1 |
| InChI | InChI=1S/C15H23FN2O2/c1-3-18-6-7-19-13(9-18)10-20-12-4-5-14(11(2)17)15(16)8-12/h4-5,8,11,13H,3,6-7,9-10,17H2,1-2H3/t11-,13?/m1/s1 |
| InChIKey | BINZQYSYKUBQBE-JTDNENJMSA-N |
| XLogP | 1.94 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |