C13H16FN3O2 — CID 107718715
2-[4-[(1S)-1-aminoethyl]-3-fluorophenoxy]-N-(2-cyanoethyl)acetamide (PubChem CID 107718715) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-[4-[(1S)-1-aminoethyl]-3-fluorophenoxy]-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-[4-[(1S)-1-aminoethyl]-3-fluorophenoxy]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 107718715 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[4-[(1S)-1-aminoethyl]-3-fluorophenoxy]-N-(2-cyanoethyl)acetamide |
| SMILES | C[C@H](N)c1ccc(OCC(=O)NCCC#N)cc1F |
| InChI | InChI=1S/C13H16FN3O2/c1-9(16)11-4-3-10(7-12(11)14)19-8-13(18)17-6-2-5-15/h3-4,7,9H,2,6,8,16H2,1H3,(H,17,18)/t9-/m0/s1 |
| InChIKey | HLQKDZADZZYMMS-VIFPVBQESA-N |
| XLogP | 1.25 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|