C15H13F3O2 — CID 107719922
(1R)-1-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]ethanol (PubChem CID 107719922) has the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is (1R)-1-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 107719922 |
| Molecular Formula | C15H13F3O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (1R)-1-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(OCc2ccc(F)c(F)c2)cc1F |
| InChI | InChI=1S/C15H13F3O2/c1-9(19)12-4-3-11(7-14(12)17)20-8-10-2-5-13(16)15(18)6-10/h2-7,9,19H,8H2,1H3/t9-/m1/s1 |
| InChIKey | OCJVRIFGMIRFMK-SECBINFHSA-N |
| XLogP | 3.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |