C54H50N4O4+2 — CID 10772009
26,28-bis[3-(4-pyridin-4-ylpyridin-1-ium-1-yl)propoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol (PubChem CID 10772009) has the molecular formula C54H50N4O4+2 and a molecular weight of 819.02 g/mol. Its IUPAC name is 26,28-bis[3-(4-pyridin-4-ylpyridin-1-ium-1-yl)propoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol.
| Compound Name | 26,28-bis[3-(4-pyridin-4-ylpyridin-1-ium-1-yl)propoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
|---|---|
| PubChem CID | 10772009 |
| Molecular Formula | C54H50N4O4+2 |
| Molecular Weight | 819.02 g/mol |
| Exact Mass | 818.38 |
| IUPAC Name | 26,28-bis[3-(4-pyridin-4-ylpyridin-1-ium-1-yl)propoxy]pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3(28),4,6,9(27),10,12,15,17,19(26),21,23-dodecaene-25,27-diol |
| SMILES | Oc1c2cccc1Cc1cccc(c1OCCC[n+]1ccc(-c3ccncc3)cc1)Cc1cccc(c1O)Cc1cccc(c1OCCC[n+]1ccc(-c3ccncc3)cc1)C2 |
| InChI | InChI=1S/C54H48N4O4/c59-51-43-7-1-8-44(51)36-48-12-4-14-50(54(48)62-34-6-28-58-31-21-42(22-32-58)40-17-25-56-26-18-40)38-46-10-2-9-45(52(46)60)37-49-13-3-11-47(35-43)53(49)61-33-5-27-57-29-19-41(20-30-57)39-15-23-55-24-16-39/h1-4,7-26,29-32H,5-6,27-28,33-38H2/p+2 |
| InChIKey | GMCIGRFYBGHKJA-UHFFFAOYSA-P |
| XLogP | 9.41 |
| TPSA | 92.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.02 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|