C14H17FN2O2 — CID 107720209
(1R)-1-[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]ethanol (PubChem CID 107720209) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]ethanol.
| Compound Name | (1R)-1-[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107720209 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (1R)-1-[2-fluoro-4-[2-(1-methylimidazol-2-yl)ethoxy]phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccc(OCCc2nccn2C)cc1F |
| InChI | InChI=1S/C14H17FN2O2/c1-10(18)12-4-3-11(9-13(12)15)19-8-5-14-16-6-7-17(14)2/h3-4,6-7,9-10,18H,5,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | JLEWURHSAAQCGC-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |