C15H18BrFN2O2 — CID 107720247
(1R)-1-[4-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methoxy]-2-fluorophenyl]ethanol (PubChem CID 107720247) has the molecular formula C15H18BrFN2O2 and a molecular weight of 357.22 g/mol. Its IUPAC name is (1R)-1-[4-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methoxy]-2-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[4-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methoxy]-2-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 107720247 |
| Molecular Formula | C15H18BrFN2O2 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | (1R)-1-[4-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methoxy]-2-fluorophenyl]ethanol |
| SMILES | CCn1nc(C)c(Br)c1COc1ccc([C@@H](C)O)c(F)c1 |
| InChI | InChI=1S/C15H18BrFN2O2/c1-4-19-14(15(16)9(2)18-19)8-21-11-5-6-12(10(3)20)13(17)7-11/h5-7,10,20H,4,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | GLNRMMKEELFKNM-SNVBAGLBSA-N |
| XLogP | 3.75 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |