C12H16FNO2S — CID 107721024
3-fluoro-4-[1-(1-oxo-1,4-thiazinan-4-yl)ethyl]phenol (PubChem CID 107721024) has the molecular formula C12H16FNO2S and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-fluoro-4-[1-(1-oxo-1,4-thiazinan-4-yl)ethyl]phenol.
| Compound Name | 3-fluoro-4-[1-(1-oxo-1,4-thiazinan-4-yl)ethyl]phenol |
|---|---|
| PubChem CID | 107721024 |
| Molecular Formula | C12H16FNO2S |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-fluoro-4-[1-(1-oxo-1,4-thiazinan-4-yl)ethyl]phenol |
| SMILES | CC(c1ccc(O)cc1F)N1CCS(=O)CC1 |
| InChI | InChI=1S/C12H16FNO2S/c1-9(14-4-6-17(16)7-5-14)11-3-2-10(15)8-12(11)13/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | PLHWKCRROGJSET-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |