C13H18N2O3 — CID 107721874
2,5-dihydroxy-N-(1-pyrrolidin-3-ylethyl)benzamide (PubChem CID 107721874) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(1-pyrrolidin-3-ylethyl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(1-pyrrolidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 107721874 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2,5-dihydroxy-N-(1-pyrrolidin-3-ylethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(O)ccc1O)C1CCNC1 |
| InChI | InChI=1S/C13H18N2O3/c1-8(9-4-5-14-7-9)15-13(18)11-6-10(16)2-3-12(11)17/h2-3,6,8-9,14,16-17H,4-5,7H2,1H3,(H,15,18) |
| InChIKey | UNJXTOPGRLEPOM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|