C14H17BrO3 — CID 107722332
2-[1-(4-bromo-3,5-dimethylphenoxy)cyclobutyl]acetic acid (PubChem CID 107722332) has the molecular formula C14H17BrO3 and a molecular weight of 313.19 g/mol. Its IUPAC name is 2-[1-(4-bromo-3,5-dimethylphenoxy)cyclobutyl]acetic acid.
| Compound Name | 2-[1-(4-bromo-3,5-dimethylphenoxy)cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 107722332 |
| Molecular Formula | C14H17BrO3 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-[1-(4-bromo-3,5-dimethylphenoxy)cyclobutyl]acetic acid |
| SMILES | Cc1cc(OC2(CC(=O)O)CCC2)cc(C)c1Br |
| InChI | InChI=1S/C14H17BrO3/c1-9-6-11(7-10(2)13(9)15)18-14(4-3-5-14)8-12(16)17/h6-7H,3-5,8H2,1-2H3,(H,16,17) |
| InChIKey | KNIAGDVKNNADOB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |