C16H19BrN2O2 — CID 107722526
6-(4-bromo-3,5-dimethylphenoxy)-2-propan-2-yloxypyridin-3-amine (PubChem CID 107722526) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 6-(4-bromo-3,5-dimethylphenoxy)-2-propan-2-yloxypyridin-3-amine.
| Compound Name | 6-(4-bromo-3,5-dimethylphenoxy)-2-propan-2-yloxypyridin-3-amine |
|---|---|
| PubChem CID | 107722526 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 6-(4-bromo-3,5-dimethylphenoxy)-2-propan-2-yloxypyridin-3-amine |
| SMILES | Cc1cc(Oc2ccc(N)c(OC(C)C)n2)cc(C)c1Br |
| InChI | InChI=1S/C16H19BrN2O2/c1-9(2)20-16-13(18)5-6-14(19-16)21-12-7-10(3)15(17)11(4)8-12/h5-9H,18H2,1-4H3 |
| InChIKey | KHABPQTUAXBGLQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |