C16H23NO3 — CID 107722905
N-(1-cyclohexylpropyl)-2,5-dihydroxybenzamide (PubChem CID 107722905) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-(1-cyclohexylpropyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(1-cyclohexylpropyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107722905 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-(1-cyclohexylpropyl)-2,5-dihydroxybenzamide |
| SMILES | CCC(NC(=O)c1cc(O)ccc1O)C1CCCCC1 |
| InChI | InChI=1S/C16H23NO3/c1-2-14(11-6-4-3-5-7-11)17-16(20)13-10-12(18)8-9-15(13)19/h8-11,14,18-19H,2-7H2,1H3,(H,17,20) |
| InChIKey | YLYJVASFABDDCL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|