C16H15BrFNO2 — CID 107723748
4-[(4-bromo-3,5-dimethylphenoxy)methyl]-3-fluorobenzamide (PubChem CID 107723748) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-[(4-bromo-3,5-dimethylphenoxy)methyl]-3-fluorobenzamide.
| Compound Name | 4-[(4-bromo-3,5-dimethylphenoxy)methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 107723748 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 4-[(4-bromo-3,5-dimethylphenoxy)methyl]-3-fluorobenzamide |
| SMILES | Cc1cc(OCc2ccc(C(N)=O)cc2F)cc(C)c1Br |
| InChI | InChI=1S/C16H15BrFNO2/c1-9-5-13(6-10(2)15(9)17)21-8-12-4-3-11(16(19)20)7-14(12)18/h3-7H,8H2,1-2H3,(H2,19,20) |
| InChIKey | AYYLMQHAMCHSNC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |