C16H16BrFO2 — CID 107724964
(1R)-1-[2-(4-bromo-3,5-dimethylphenoxy)-6-fluorophenyl]ethanol (PubChem CID 107724964) has the molecular formula C16H16BrFO2 and a molecular weight of 339.20 g/mol. Its IUPAC name is (1R)-1-[2-(4-bromo-3,5-dimethylphenoxy)-6-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-(4-bromo-3,5-dimethylphenoxy)-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 107724964 |
| Molecular Formula | C16H16BrFO2 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (1R)-1-[2-(4-bromo-3,5-dimethylphenoxy)-6-fluorophenyl]ethanol |
| SMILES | Cc1cc(Oc2cccc(F)c2[C@@H](C)O)cc(C)c1Br |
| InChI | InChI=1S/C16H16BrFO2/c1-9-7-12(8-10(2)16(9)17)20-14-6-4-5-13(18)15(14)11(3)19/h4-8,11,19H,1-3H3/t11-/m1/s1 |
| InChIKey | WINOTQPURBVYCX-LLVKDONJSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |