C15H13BrCl2O — CID 107725024
2-bromo-5-[3-chloro-2-(chloromethyl)phenoxy]-1,3-dimethylbenzene (PubChem CID 107725024) has the molecular formula C15H13BrCl2O and a molecular weight of 360.08 g/mol. Its IUPAC name is 2-bromo-5-[3-chloro-2-(chloromethyl)phenoxy]-1,3-dimethylbenzene.
| Compound Name | 2-bromo-5-[3-chloro-2-(chloromethyl)phenoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 107725024 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 2-bromo-5-[3-chloro-2-(chloromethyl)phenoxy]-1,3-dimethylbenzene |
| SMILES | Cc1cc(Oc2cccc(Cl)c2CCl)cc(C)c1Br |
| InChI | InChI=1S/C15H13BrCl2O/c1-9-6-11(7-10(2)15(9)16)19-14-5-3-4-13(18)12(14)8-17/h3-7H,8H2,1-2H3 |
| InChIKey | DEPJRZWRASWISC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|