C13H13BrN2O2 — CID 107725618
[6-(4-bromo-3,5-dimethylphenoxy)pyridazin-3-yl]methanol (PubChem CID 107725618) has the molecular formula C13H13BrN2O2 and a molecular weight of 309.16 g/mol. Its IUPAC name is [6-(4-bromo-3,5-dimethylphenoxy)pyridazin-3-yl]methanol.
| Compound Name | [6-(4-bromo-3,5-dimethylphenoxy)pyridazin-3-yl]methanol |
|---|---|
| PubChem CID | 107725618 |
| Molecular Formula | C13H13BrN2O2 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [6-(4-bromo-3,5-dimethylphenoxy)pyridazin-3-yl]methanol |
| SMILES | Cc1cc(Oc2ccc(CO)nn2)cc(C)c1Br |
| InChI | InChI=1S/C13H13BrN2O2/c1-8-5-11(6-9(2)13(8)14)18-12-4-3-10(7-17)15-16-12/h3-6,17H,7H2,1-2H3 |
| InChIKey | RFPGPDDXXPLXEJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |