C14H12Br2ClNO — CID 107725632
5-bromo-2-(4-bromo-3,5-dimethylphenoxy)-3-(chloromethyl)pyridine (PubChem CID 107725632) has the molecular formula C14H12Br2ClNO and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-bromo-2-(4-bromo-3,5-dimethylphenoxy)-3-(chloromethyl)pyridine.
| Compound Name | 5-bromo-2-(4-bromo-3,5-dimethylphenoxy)-3-(chloromethyl)pyridine |
|---|---|
| PubChem CID | 107725632 |
| Molecular Formula | C14H12Br2ClNO |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 5-bromo-2-(4-bromo-3,5-dimethylphenoxy)-3-(chloromethyl)pyridine |
| SMILES | Cc1cc(Oc2ncc(Br)cc2CCl)cc(C)c1Br |
| InChI | InChI=1S/C14H12Br2ClNO/c1-8-3-12(4-9(2)13(8)16)19-14-10(6-17)5-11(15)7-18-14/h3-5,7H,6H2,1-2H3 |
| InChIKey | OTRLXJBNVRWPIC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|