C15H19BrN2O2 — CID 107725754
N-[[2-(4-bromo-3,5-dimethylphenoxy)-1,3-oxazol-4-yl]methyl]propan-1-amine (PubChem CID 107725754) has the molecular formula C15H19BrN2O2 and a molecular weight of 339.23 g/mol. Its IUPAC name is N-[[2-(4-bromo-3,5-dimethylphenoxy)-1,3-oxazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-bromo-3,5-dimethylphenoxy)-1,3-oxazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107725754 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | N-[[2-(4-bromo-3,5-dimethylphenoxy)-1,3-oxazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1coc(Oc2cc(C)c(Br)c(C)c2)n1 |
| InChI | InChI=1S/C15H19BrN2O2/c1-4-5-17-8-12-9-19-15(18-12)20-13-6-10(2)14(16)11(3)7-13/h6-7,9,17H,4-5,8H2,1-3H3 |
| InChIKey | YDXVXMRNGZIVLH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|