About N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine
N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine (PubChem CID 107726655) has the molecular formula C16H26BrNO
and a molecular weight of 328.29 g/mol. Its IUPAC name is N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine.
Molecular Properties
| Compound Name | N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine |
| PubChem CID | 107726655 |
| Molecular Formula | C16H26BrNO |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine |
| SMILES | CCC(C)(C)NCC(C)Oc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C16H26BrNO/c1-7-16(5,6)18-10-13(4)19-14-8-11(2)15(17)12(3)9-14/h8-9,13,18H,7,10H2,1-6H3 |
| InChIKey | IXFWVXGYICMTTI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine?
The IUPAC name of N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine (CID 107726655) is N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine.
What is the SMILES notation for N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine?
The canonical SMILES for N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine is CCC(C)(C)NCC(C)Oc1cc(C)c(Br)c(C)c1.
What is the InChIKey of N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine?
The InChIKey is IXFWVXGYICMTTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26BrNO/c1-7-16(5,6)18-10-13(4)19-14-8-11(2)15(17)12(3)9-14/h8-9,13,18H,7,10H2,1-6H3.
What are the key properties of N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine?
N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine has a molecular weight of 328.29 g/mol, XLogP of 4.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-bromo-3,5-dimethylphenoxy)propyl]-2-methylbutan-2-amine is sourced from PubChem (CID 107726655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).