About 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene
2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene (PubChem CID 107727221) has the molecular formula C14H18BrClO
and a molecular weight of 317.65 g/mol. Its IUPAC name is 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene |
| PubChem CID | 107727221 |
| Molecular Formula | C14H18BrClO |
| Molecular Weight | 317.65 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene |
| SMILES | Cc1cc(OC2CC(Cl)C2(C)C)cc(C)c1Br |
| InChI | InChI=1S/C14H18BrClO/c1-8-5-10(6-9(2)13(8)15)17-12-7-11(16)14(12,3)4/h5-6,11-12H,7H2,1-4H3 |
| InChIKey | BPLKLLKLOBGWFG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene?
The IUPAC name of 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene (CID 107727221) is 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene.
What is the SMILES notation for 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene?
The canonical SMILES for 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene is Cc1cc(OC2CC(Cl)C2(C)C)cc(C)c1Br.
What is the InChIKey of 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene?
The InChIKey is BPLKLLKLOBGWFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrClO/c1-8-5-10(6-9(2)13(8)15)17-12-7-11(16)14(12,3)4/h5-6,11-12H,7H2,1-4H3.
What are the key properties of 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene?
2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene has a molecular weight of 317.65 g/mol, XLogP of 4.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-(3-chloro-2,2-dimethylcyclobutyl)oxy-1,3-dimethylbenzene is sourced from PubChem (CID 107727221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).