C14H17NO6 — CID 107728193
4-[[(3,4-dihydroxybenzoyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 107728193) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-[[(3,4-dihydroxybenzoyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(3,4-dihydroxybenzoyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 107728193 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[[(3,4-dihydroxybenzoyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCOCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H17NO6/c16-10-2-1-9(7-11(10)17)12(18)15-8-14(13(19)20)3-5-21-6-4-14/h1-2,7,16-17H,3-6,8H2,(H,15,18)(H,19,20) |
| InChIKey | QLERWSZMEOGQHB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|