C11H16N2O3 — CID 107728277
3,4-dihydroxy-N-[2-(methylamino)propyl]benzamide (PubChem CID 107728277) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[2-(methylamino)propyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[2-(methylamino)propyl]benzamide |
|---|---|
| PubChem CID | 107728277 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 3,4-dihydroxy-N-[2-(methylamino)propyl]benzamide |
| SMILES | CNC(C)CNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H16N2O3/c1-7(12-2)6-13-11(16)8-3-4-9(14)10(15)5-8/h3-5,7,12,14-15H,6H2,1-2H3,(H,13,16) |
| InChIKey | IREHAMQEAYDPDV-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|