C14H12N2O3S — CID 107728355
N-(3-carbamothioylphenyl)-3,4-dihydroxybenzamide (PubChem CID 107728355) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(3-carbamothioylphenyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107728355 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(3-carbamothioylphenyl)-3,4-dihydroxybenzamide |
| SMILES | NC(=S)c1cccc(NC(=O)c2ccc(O)c(O)c2)c1 |
| InChI | InChI=1S/C14H12N2O3S/c15-13(20)8-2-1-3-10(6-8)16-14(19)9-4-5-11(17)12(18)7-9/h1-7,17-18H,(H2,15,20)(H,16,19) |
| InChIKey | MZGWGUCZBTYRSS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|